CymitQuimica logo

CAS 213831-01-7

:

N-(3-Amino-4-chlorophenyl)propanamide

Description:
N-(3-Amino-4-chlorophenyl)propanamide is an organic compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This substance features a propanamide backbone with an amino group and a chlorophenyl substituent, specifically a 3-amino-4-chlorophenyl group, which contributes to its chemical properties and potential biological activity. The presence of the chlorine atom on the phenyl ring can influence the compound's reactivity and solubility, while the amino group may participate in hydrogen bonding and enhance its interaction with biological targets. This compound may be of interest in medicinal chemistry due to its structural features that could be relevant for drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, safety and handling precautions should be observed, and its stability, solubility, and reactivity should be evaluated in specific contexts.
Formula:C9H11ClN2O
InChI:InChI=1S/C9H11ClN2O/c1-2-9(13)12-6-3-4-7(10)8(11)5-6/h3-5H,2,11H2,1H3,(H,12,13)
InChI key:InChIKey=XTYFFONNCYYVOA-UHFFFAOYSA-N
SMILES:N(C(CC)=O)C1=CC(N)=C(Cl)C=C1
Synonyms:
  • Propanamide, N-(3-amino-4-chlorophenyl)-
  • N-(3-Amino-4-chlorophenyl)propanamide
Found 2 products.