CymitQuimica logo

CAS 2140301-98-8

:

Description:
The chemical substance with the CAS number 2140301-98-8 is known as a specific compound, but detailed information about it may not be widely available in public databases. Generally, compounds are characterized by their molecular structure, functional groups, physical properties (such as melting point, boiling point, and solubility), and chemical reactivity. The characteristics of a chemical substance can also include its applications in various fields, such as pharmaceuticals, agriculture, or materials science. Additionally, safety data, including toxicity and handling precautions, are crucial for understanding how to work with the substance safely. For precise information, including its specific properties and applications, consulting specialized chemical databases or scientific literature is recommended.
Formula:C25H36F3N5O3·C4H6O4
InChI:InChI=1S/C25H36F3N5O3.C4H6O4/c1-15(2)24(6-4-16(10-24)31-19-5-7-36-13-20(19)35-3)23(34)33-12-17-8-18(33)11-32(17)22-9-21(25(26,27)28)29-14-30-22;5-3(6)1-2-4(7)8/h9,14-20,31H,4-8,10-13H2,1-3H3;1-2H2,(H,5,6)(H,7,8)/t16-,17+,18+,19+,20-,24+;/m1./s1
InChI key:InChIKey=WRPPUEHVLSHXJG-HTQYHTRRSA-N
SMILES:C(=O)([C@]1([C@H](C)C)C[C@H](N[C@@H]2[C@H](OC)COCC2)CC1)N3[C@@]4(CN([C@](C3)(C4)[H])C=5C=C(C(F)(F)F)N=CN5)[H].C(CC(O)=O)C(O)=O
Found 3 products.