CymitQuimica logo

CAS 214193-10-9

:

N-Boc-L-trans-4,5-methanoproline ethyl ester

Description:
N-Boc-L-trans-4,5-methanoproline ethyl ester is a chemical compound characterized by its unique structure, which includes a bicyclic proline derivative. The "N-Boc" (tert-butoxycarbonyl) group serves as a protecting group for the amine, enhancing the compound's stability and solubility in organic solvents. This compound features a trans configuration at the 4 and 5 positions of the proline ring, which is significant for its conformational properties and potential biological activity. The ethyl ester moiety contributes to its lipophilicity, making it suitable for various synthetic applications, particularly in peptide synthesis and drug development. The compound is typically used in research settings, especially in the fields of medicinal chemistry and biochemistry, due to its ability to mimic natural amino acids while providing unique reactivity. Its CAS number, 214193-10-9, allows for easy identification and retrieval of information regarding its properties and applications in scientific literature. Overall, N-Boc-L-trans-4,5-methanoproline ethyl ester is a valuable intermediate in the synthesis of more complex molecules.
Formula:C13H21NO4
InChI:InChI=1S/C13H21NO4/c1-5-17-11(15)10-7-8-6-9(8)14(10)12(16)18-13(2,3)4/h8-10H,5-7H2,1-4H3/t8-,9-,10+/m1/s1
InChI key:QHWOZJGWXZDMDZ-BBBLOLIVSA-N
SMILES:CCOC(=O)[C@@H]1C[C@H]2C[C@H]2N1C(=O)OC(C)(C)C
Synonyms:
  • O2-tert-butyl O3-ethyl (1R,3S,5R)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate
  • N-Boc-L-trans-4,5-methanoproline ethyl ester
  • Saxagliptin Impurity 47
  • 2-Azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid, 2-(1,1-dimethylethyl) 3-ethyl ester, (1R,3S,5R)-
Found 4 products.