CymitQuimica logo

CAS 214193-11-0

:

2-Azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid, 2-(1,1-dimethylethyl)3-ethyl ester, (1S,3S,5S)-

Description:
2-Azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid, 2-(1,1-dimethylethyl)-3-ethyl ester, (1S,3S,5S)- is a bicyclic compound characterized by its unique azabicyclic structure, which incorporates a nitrogen atom into a bicyclic framework. This compound features two carboxylic acid functional groups, contributing to its potential acidity and reactivity. The presence of the tert-butyl and ethyl ester groups enhances its lipophilicity, which may influence its solubility and biological activity. The stereochemistry indicated by the (1S,3S,5S)- configuration suggests specific spatial arrangements of substituents around the chiral centers, which can significantly affect the compound's pharmacological properties. This compound may be of interest in medicinal chemistry and drug design due to its structural complexity and potential biological activity. Its CAS number, 214193-11-0, allows for easy identification and retrieval of information in chemical databases. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.
Formula:C13H21NO4
InChI:InChI=1S/C13H21NO4/c1-5-17-11(15)10-7-8-6-9(8)14(10)12(16)18-13(2,3)4/h8-10H,5-7H2,1-4H3/t8-,9-,10-/m0/s1
InChI key:QHWOZJGWXZDMDZ-GUBZILKMSA-N
SMILES:CCOC(=O)[C@@H]1C[C@@H]2C[C@@H]2N1C(=O)OC(C)(C)C
Found 5 products.