CAS 214358-33-5
:N-[(1E)-1-aminoethylidene][3-(ammoniomethyl)phenyl]methanaminium
Description:
N-[(1E)-1-aminoethylidene][3-(ammoniomethyl)phenyl]methanaminium, with the CAS number 214358-33-5, is a complex organic compound characterized by its unique structural features. It contains an amino group, which contributes to its basicity and potential for forming salts. The presence of an ethylene bridge and a phenyl group indicates that it may exhibit aromatic properties, influencing its reactivity and interaction with other molecules. This compound likely possesses polar characteristics due to the presence of multiple functional groups, which can facilitate hydrogen bonding and solubility in polar solvents. Additionally, the ammonium group suggests that it can participate in ionic interactions, making it potentially useful in various applications, including pharmaceuticals and materials science. Its specific stereochemistry, indicated by the (1E) configuration, may also play a role in its biological activity and interaction with biological systems. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in chemical research and applications.
Formula:C10H17N3
InChI:InChI=1/C10H15N3/c1-8(12)13-7-10-4-2-3-9(5-10)6-11/h2-5H,6-7,11H2,1H3,(H2,12,13)/p+2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-(3-(Aminomethyl)benzyl)acetimidamide dihydrochloride
CAS:Formula:C10H17Cl2N3Purity:99%Color and Shape:SolidMolecular weight:250.1681N-(3-Aminomethyl)benzylacetamidine
CAS:M02676 - N-(3-Aminomethyl)benzylacetamidine
Formula:C10H17Cl2N3Color and Shape:SolidMolecular weight:250.171400W dihydrochloride
CAS:1400W dihydrochloride (N-(3-(Aminomethyl)benzyl)acetamidine) is a highly effective and specific inhibitor of inducible NOS2 (iNOS).Formula:C10H17Cl2N3Purity:98% - 99.94%Color and Shape:SolidMolecular weight:250.17Ref: TM-T3491
5mg48.00€1mL*10mM (DMSO)50.00€10mg71.00€25mg118.00€50mg207.00€100mg354.00€200mg460.00€500mg747.00€1400W dihydrochloride
CAS:Formula:C10H15N3·2HClPurity:≥ 98%Color and Shape:White to off-white powder or solidMolecular weight:250.17N-(3-(Aminomethyl)benzyl)acetamidine Dihydrochloride
CAS:Controlled ProductApplications N-(3-(Aminomethyl)benzyl)acetamidine Dihydrochloride is a selective inducible nitric oxide synthase (iNOS) inhibitor (1, 2, 3). A long-acting human iNOS inhibitor possessing an IC50 value of 2.0uM (1).
References (1) Garvey, E.P., et al.: J. Biol. Chem. (1997) 272: 4959-63 (2) Thomsen, L.L., et al.: Cancer Res. (1997) 57: 3300-4(3) Archer, E. J., et al.: ACS Synth. Biol. (2012) 1: 451–457Formula:C10H15N3·2ClHColor and Shape:NeatMolecular weight:250.171400W dihydrochloride
CAS:Inhibitor of inducible nitric oxide synthase
Formula:C10H17Cl2N3Purity:Min. 95%Molecular weight:250.17 g/mol






