CymitQuimica logo

CAS 214398-99-9

:

2-Pyrrolidinecarboxamide,1-(2-chloroacetyl)-, (2S)-

Description:
2-Pyrrolidinecarboxamide, 1-(2-chloroacetyl)-, (2S)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. The presence of a carboxamide functional group indicates that it contains an amine bonded to a carbonyl group, contributing to its potential as a polar molecule. The specific substitution of a 2-chloroacetyl group at the 1-position of the pyrrolidine ring introduces a chloroacetyl moiety, which can enhance reactivity and influence biological activity. The (2S)- designation indicates that the compound has a specific stereochemistry, which can be crucial for its interaction with biological systems, potentially affecting its pharmacological properties. This compound may exhibit various properties such as solubility in polar solvents, and its reactivity can be influenced by the presence of the chloroacetyl group. Overall, 2-Pyrrolidinecarboxamide, 1-(2-chloroacetyl)-, (2S)- is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.
Formula:C7H11ClN2O2
InChI:InChI=1S/C7H11ClN2O2/c8-4-6(11)10-3-1-2-5(10)7(9)12/h5H,1-4H2,(H2,9,12)/t5-/m0/s1
InChI key:YKDRUBGIBPCRBH-YFKPBYRVSA-N
SMILES:C1C[C@H](N(C1)C(=O)CCl)C(=O)N
Synonyms:
  • 2-Pyrrolidinecarboxamide,1-(chloroacetyl)-, (2S)-
  • Vildagliptin intermediate 3
  • (S)-1-(2-Chloroacetyl)pyrrolidine-2-carboxaMide
Found 9 products.