CAS 214467-60-4
:N-[(2R,3R,4R,5S,6R)-2-azido-4,5-dibenzyloxy-6-(benzyloxymethyl)tetrahydropyran-3-yl]acetamide
Description:
N-[(2R,3R,4R,5S,6R)-2-azido-4,5-dibenzyloxy-6-(benzyloxymethyl)tetrahydropyran-3-yl]acetamide, with CAS number 214467-60-4, is a complex organic compound characterized by its azido functional group and a tetrahydropyran ring structure. This compound features multiple benzyl ether substituents, which contribute to its hydrophobic properties and potential for solubility in organic solvents. The presence of the acetamide group indicates that it may exhibit amide-like reactivity, making it a candidate for various chemical transformations. The stereochemistry of the molecule, denoted by the specific R and S configurations, suggests that it may exhibit chirality, which can influence its biological activity and interactions with other molecules. Such compounds are often of interest in medicinal chemistry and synthetic organic chemistry due to their potential applications in drug development and as intermediates in the synthesis of more complex molecules. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research and application in various chemical fields.
Formula:C29H32N4O5
InChI:InChI=1/C29H32N4O5/c1-21(34)31-26-28(37-19-24-15-9-4-10-16-24)27(36-18-23-13-7-3-8-14-23)25(38-29(26)32-33-30)20-35-17-22-11-5-2-6-12-22/h2-16,25-29H,17-20H2,1H3,(H,31,34)/t25-,26-,27-,28-,29-/m1/s1
SMILES:CC(=N[C@@H]1[C@H]([C@@H]([C@@H](COCc2ccccc2)O[C@H]1N=[N+]=[NH-])OCc1ccccc1)OCc1ccccc1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-β-D-glucopyranosyl Azide
CAS:2-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-β-D-glucopyranosyl AzideFormula:C29H32N4O5Purity:>98.0%Molecular weight:516.62-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-β-D-glucopyranosyl Azide
CAS:Formula:C29H32N4O5Purity:98.0%Color and Shape:SolidMolecular weight:516.58822-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-β-D-glucopyranosyl Azide
CAS:Formula:C29H32N4O5Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:516.602-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-b-D-glucopyranosyl azide
CAS:2-Acetamido-3,4,6-tri-O-benzyl-2-deoxy-b-D-glucopyranosyl azide is a custom synthesis of an oligosaccharide that has been modified with fluorination and methylation. This carbohydrate is a sugar that can be used in the production of glycosylations or click chemistry reactions. It is a complex carbohydrate with high purity and can be used for research purposes or other applications.Formula:C29H32N4O5Purity:Min. 95%Molecular weight:516.59 g/mol1-[(2R,3R,4R,5S,6R)-4,5-bis(benzyloxy)-6-[(benzyloxy)methyl]-3-acetamidooxan-2-yl]triaz-2-yn-2-ium-1-ide
CAS:Purity:98%Molecular weight:516.5980225






