CymitQuimica logo

CAS 214557-89-8

:

3,5,7-Trifluoroadamantane-1-carboxylic acid

Description:
3,5,7-Trifluoroadamantane-1-carboxylic acid is a fluorinated derivative of adamantane, characterized by the presence of three fluorine atoms at the 3, 5, and 7 positions of the adamantane structure, along with a carboxylic acid functional group at the 1-position. This compound exhibits unique properties due to the presence of fluorine, which enhances its lipophilicity and stability, making it potentially useful in various applications, including pharmaceuticals and materials science. The carboxylic acid group contributes to its acidity and solubility in polar solvents. Additionally, the adamantane framework provides a rigid, cage-like structure that can influence the compound's reactivity and interaction with biological systems. The trifluoromethyl groups can also impart distinctive electronic properties, affecting the compound's behavior in chemical reactions. Overall, 3,5,7-Trifluoroadamantane-1-carboxylic acid is a compound of interest for its potential applications in drug design and development, as well as in the synthesis of novel materials.
Formula:C11H13F3O2
InChI:InChI=1S/C11H13F3O2/c12-9-1-8(7(15)16)2-10(13,4-9)6-11(14,3-8)5-9/h1-6H2,(H,15,16)
InChI key:QBRDOUHHJWRTHN-UHFFFAOYSA-N
SMILES:C1C2(CC3(CC1(CC(C2)(C3)F)F)F)C(=O)O
Synonyms:
  • Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3,5,7-trifluoro-
Found 3 products.