CymitQuimica logo

CAS 214760-18-6

:

Benzonitrile,4-acetyl-2-fluoro-

Description:
Benzonitrile, 4-acetyl-2-fluoro- is an organic compound characterized by the presence of a benzonitrile moiety with a fluorine atom and an acetyl group attached to the aromatic ring. Its molecular structure features a cyano group (-C≡N) linked to a benzene ring, which is further substituted at the para position with an acetyl group (-COCH3) and at the ortho position with a fluorine atom. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its moderate polarity, which allows it to dissolve in various organic solvents. The presence of the cyano group contributes to its reactivity, making it useful in various chemical syntheses and applications in pharmaceuticals and agrochemicals. Additionally, the fluorine substitution can enhance the compound's biological activity and lipophilicity. Safety data should be consulted, as compounds with nitrile groups can be toxic and require careful handling.
Formula:C9H6FNO
InChI:InChI=1S/C9H6FNO/c1-6(12)7-2-3-8(5-11)9(10)4-7/h2-4H,1H3
InChI key:JWNHQAOIXWUFMG-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC(=C(C=C1)C#N)F
Synonyms:
  • 4-Acetyl-2-fluorobenzonitrile
Found 4 products.