CymitQuimica logo

CAS 215306-02-8

:

2-Chloro-3,4-pyridinedicarboxylic acid

Description:
2-Chloro-3,4-pyridinedicarboxylic acid, with the CAS number 215306-02-8, is a heterocyclic organic compound featuring a pyridine ring substituted with two carboxylic acid groups and a chlorine atom. This compound typically appears as a crystalline solid and is characterized by its polar nature due to the presence of carboxylic acid functional groups, which can engage in hydrogen bonding. The chlorine substituent introduces additional reactivity and can influence the compound's solubility and interaction with other molecules. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of multiple functional groups allows for various chemical transformations, making it a versatile compound in synthetic chemistry. Additionally, its structural features may impart specific biological activities, warranting further investigation in medicinal chemistry contexts. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H4ClNO4
InChI:InChI=1/C7H4ClNO4/c8-5-4(7(12)13)3(6(10)11)1-2-9-5/h1-2H,(H,10,11)(H,12,13)
InChI key:IFFHNAPSEFZPIR-UHFFFAOYSA-N
SMILES:c1cnc(c(c1C(=O)O)C(=O)O)Cl
Synonyms:
  • 2-Chloropyridine-3,4-Dicarboxylic Acid
Found 4 products.