CAS 215527-70-1
:(~2~H_5_)phenylboronic acid
Description:
(2-Hydroxyphenyl)boronic acid, with the CAS number 215527-70-1, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a hydroxyl group in the ortho position. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl group. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols and sugars, making it useful in various applications such as organic synthesis, medicinal chemistry, and as a reagent in the development of sensors. The compound is also known for its role in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, (2-Hydroxyphenyl)boronic acid can participate in various chemical transformations due to its electrophilic nature, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as with all boronic acids, due to potential irritant properties.
Formula:C6H2D5BO2
InChI:InChI=1/C6H7BO2/c8-7(9)6-4-2-1-3-5-6/h1-5,8-9H/i1D,2D,3D,4D,5D
SMILES:c1(c(c(c(c(c1[2H])[2H])B(O)O)[2H])[2H])[2H]
Synonyms:- Phenyl-D5-boronicacid
- Phenyl-d5-boronic Acid:
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2,3,4,5,6-Pentadeuteriophenyl)boronic acid
CAS:(2,3,4,5,6-Pentadeuteriophenyl)boronic acidFormula:C6H2BD5O2Purity:97%Color and Shape:SolidMolecular weight:126.96038Phenyl-D5-boronic acid
CAS:Phenyl-D5-boronic acid is the deuterium labeled Phenylboronic acid (T30355). Phenylboronic acid is used in organic synthesis cross coupling reactions.Formula:C6H7BO2Molecular weight:126.96Phenylboronic Acid-d5
CAS:Controlled ProductStability Hygroscopic
Applications Phenylboronic Acid-d5 is the isotope labelled analog of Phenylboronic Acid (P319590); a compound used in the organic synthesis of various pharmaceutical goods.
References Ainley, A.D., et al.: J. Chem. Soc., 2171 (1930)Formula:C6H2D5BO2Color and Shape:NeatMolecular weight:126.96





