CymitQuimica logo

CAS 215589-24-5

:

4-(4-fluorophenoxy)benzonitrile

Description:
4-(4-Fluorophenoxy)benzonitrile, with the CAS number 215589-24-5, is an organic compound characterized by its aromatic structure, which includes a benzonitrile moiety and a fluorophenoxy group. This compound features a nitrile functional group (-C≡N) attached to a benzene ring, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the fluorine atom in the para position of the phenoxy group can enhance the compound's lipophilicity and influence its biological activity. Typically, compounds like this exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the substituents present. Additionally, 4-(4-fluorophenoxy)benzonitrile may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its unique structural features make it a subject of interest in synthetic organic chemistry and material science, where it may serve as an intermediate or a building block for more complex molecules.
Formula:C13H8FNO
InChI:InChI=1/C13H8FNO/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12/h1-8H
InChI key:NXVPHQNXBDDVCT-UHFFFAOYSA-N
SMILES:c1cc(ccc1C#N)Oc1ccc(cc1)F
Synonyms:
  • Benzonitrile, 4-(4-Fluorophenoxy)-
  • 4-(4-Fluorophenoxy)benzonitrile
Found 4 products.