CAS 2156-04-9
:4-Vinylbenzeneboronic acid
Description:
4-Vinylbenzeneboronic acid, with the CAS number 2156-04-9, is an organic compound that features both a vinyl group and a boronic acid functional group. It is characterized by its ability to participate in various chemical reactions, particularly in the formation of covalent bonds with diols and other nucleophiles, making it valuable in organic synthesis and materials science. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. Its boronic acid moiety allows for reversible interactions with biomolecules, which is particularly useful in drug development and sensor applications. Additionally, 4-vinylbenzeneboronic acid can undergo polymerization, leading to the formation of cross-linked networks, which are utilized in the production of hydrogels and other advanced materials. The compound is also noted for its potential in medicinal chemistry, especially in the development of targeted therapies due to its ability to form stable complexes with certain biological targets.
Formula:C8H9BO2
InChI:InChI=1/C8H9BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6,10-11H,1H2
SMILES:C=Cc1ccc(cc1)B(O)O
Synonyms:- 4-Vinylphenylboronic acid
- Styrene-4-boronic acid
- (4-Ethenylphenyl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Vinylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H9BO2Purity:97.0 to 114.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:147.974-Vinylbenzeneboronic acid, 97%
CAS:4-Vinylbenzeneboronic acid is widely used in Suzuki reaction. It is also used in the preparation of boronic acid containing polymers, which is used in potential biomedical applications. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some docuFormula:C8H9BO2Purity:97%Color and Shape:White to pale cream, PowderMolecular weight:147.974-Vinylphenylboronic acid
CAS:Formula:C8H9BO2Purity:97%Color and Shape:Solid, Crystalline Powder or Fibers or Flakes or PowderMolecular weight:147.974-Vinylbenzeneboronic acid
CAS:4-Vinylbenzeneboronic acidFormula:C8H9BO2Purity:97%Molecular weight:147.97BORONIC ACID, B-(4-ETHENYLPHENYL)-
CAS:Formula:C8H9BO2Purity:97%Color and Shape:SolidMolecular weight:147.96694-Vinylbenzeneboronic acid
CAS:4-Vinylbenzeneboronic acidFormula:C8H9BO2Purity:97%Color and Shape:White to pale cream Solid-PowderMolecular weight:147.966864-Vinylbenzeneboronic acid
CAS:4-Vinylbenzeneboronic acid is a boronate ester that is used as a reaction component and a reagent in organic synthesis.Formula:C8H9BO2Molecular weight:147.97 g/mol







