CAS 21568-87-6
:(S)-3-Amino-2-azepanone
Description:
(S)-3-Amino-2-azepanone, with the CAS number 21568-87-6, is a cyclic amino acid derivative characterized by its seven-membered ring structure, which includes an amine and a carbonyl functional group. This compound is a chiral molecule, with the (S) configuration indicating the specific spatial arrangement of its atoms. It typically exhibits properties associated with amino acids, such as the ability to participate in hydrogen bonding due to the presence of both an amino group (-NH2) and a carbonyl group (C=O). The azepanone ring contributes to its stability and reactivity, making it of interest in various chemical syntheses and biological applications. Its solubility in polar solvents is common, and it may exhibit basic properties due to the amino group. Additionally, (S)-3-Amino-2-azepanone can serve as a building block in the synthesis of more complex molecules, particularly in the fields of medicinal chemistry and drug development, where its stereochemistry can influence biological activity.
Formula:C6H12N2O
InChI:InChI=1/C6H12N2O/c7-5-3-1-2-4-8-6(5)9/h5H,1-4,7H2,(H,8,9)/t5-/m0/s1
SMILES:C1CCN=C([C@H](C1)N)O
Synonyms:- (3R)-3-Aminoazepan-2-one
- L-a-Amino-e-caprolactam
- L-alpha-amino-epsilon-caprolactam
- (3S)-3-aminoazepan-2-one
- (S)-a-Amino-omega-caprolactam
- (S)-3-amino-hexahydro-2-azepinone
- (S)-3-Amino-Azepan-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-a-Amino-ω-caprolactam
CAS:Formula:C6H12N2OPurity:99.0%Color and Shape:SolidMolecular weight:128.175(S)-3-Amino-hexahydro-2-azepinone
CAS:(S)-3-Amino-hexahydro-2-azepinoneFormula:C6H12N2OPurity:98%Molecular weight:128.17227(S)-3-Amino-2-azepanone (>90%)
CAS:Controlled ProductApplications (S)-3-Amino-2-azepanone is a useful research chemical. It is used as an intermediate in the synthesis of bengamide E analogs and capuramycin and its analogs as antibacterial agents.
References Phi, T. D., et al.: Tetrahedron Lett., 58, 1830 (2017); Wang, Y., Chem. A. Eur. J., 19, 13847 (2013)Formula:C6H12N2OPurity:>90%Color and Shape:NeatMolecular weight:128.173-Amino-2-azepanone (Racemic mixture)
CAS:Controlled ProductFormula:C6H12N2OColor and Shape:NeatMolecular weight:128.172



