CymitQuimica logo

CAS 2159-40-2

:

2-(4-Bromobenzoyl)benzoic acid

Description:
2-(4-Bromobenzoyl)benzoic acid, with the CAS number 2159-40-2, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid group (-COOH) attached to a benzene ring, and a bromobenzoyl substituent at the 2-position of the benzoic acid. The presence of the bromine atom enhances its electrophilic properties and can influence its reactivity and solubility in various solvents. This compound is typically a white to off-white solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. Its chemical properties make it useful in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Proper handling and safety measures should be observed due to the potential hazards associated with brominated compounds.
Formula:C14H9BrO3
InChI:InChI=1S/C14H9BrO3/c15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h1-8H,(H,17,18)
InChI key:InChIKey=NONNFIAFWRSPPY-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(O)=O)C=CC=C1)C2=CC=C(Br)C=C2
Synonyms:
  • Benzoic acid, o-(p-bromobenzoyl)-
  • o-(p-Bromobenzoyl)benzoic acid
  • 2-(4-Bromobenzoyl)benzoic acid
  • Benzoic acid, 2-(4-bromobenzoyl)-
  • NSC 82294
Found 5 products.