CymitQuimica logo

CAS 216309-02-3

:

2H-1-Benzopyran-3-acetamide,7-amino-N-[6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-4-methyl-2-oxo-

Description:
2H-1-Benzopyran-3-acetamide, 7-amino-N-[6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-4-methyl-2-oxo- is a complex organic compound characterized by its multi-functional structure, which includes a benzopyran core, an acetamide group, and a pyrrolidine derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural motifs, which may interact with biological targets. The presence of the benzopyran moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as benzopyrans are often associated with various biological activities, including anti-inflammatory and antioxidant effects. The acetamide and pyrrolidine components may enhance its pharmacological profile, influencing its interaction with enzymes or receptors. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in drug design and synthesis. As with many complex organic molecules, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C22H25N3O7
InChI:InChI=1S/C22H25N3O7/c1-13-15-7-6-14(23)11-17(15)31-22(30)16(13)12-18(26)24-10-4-2-3-5-21(29)32-25-19(27)8-9-20(25)28/h6-7,11H,2-5,8-10,12,23H2,1H3,(H,24,26)
InChI key:QYSJBOMZRLAPJR-UHFFFAOYSA-N
SMILES:CC1=C(C(=O)OC2=C1C=CC(=C2)N)CC(=O)NCCCCCC(=O)ON3C(=O)CCC3=O
Found 6 products.