CymitQuimica logo

CAS 216393-67-8

:

4-Chloro-2-fluoro-6-iodoaniline

Description:
4-Chloro-2-fluoro-6-iodoaniline is an organic compound characterized by the presence of multiple halogen substituents on an aniline structure. It features a benzene ring with an amino group (-NH2) attached, along with chlorine (Cl), fluorine (F), and iodine (I) atoms at specific positions on the ring. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents and varying melting and boiling points, influenced by its halogen content. The presence of these halogens can significantly affect the compound's reactivity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. Additionally, the compound's halogen substituents can enhance its biological activity and influence its interaction with biological systems. Safety precautions should be taken when handling this compound, as halogenated anilines can pose health risks and environmental concerns.
Formula:C6H4ClFIN
InChI:InChI=1/C6H4ClFIN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2
InChI key:SSNQXCONXNVTJN-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1F)N)I)Cl
Found 5 products.