CAS 2170-06-1
:Phenylethynyltrimethylsilane
Description:
Phenylethynyltrimethylsilane, with the CAS number 2170-06-1, is an organosilicon compound characterized by the presence of a phenylethynyl group attached to a trimethylsilyl moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its stability and low volatility. It is soluble in organic solvents such as ether and benzene but is generally insoluble in water due to its hydrophobic nature. The presence of the trimethylsilyl group imparts unique reactivity, making it useful in various synthetic applications, particularly in organic synthesis and materials science. Phenylethynyltrimethylsilane can participate in cross-coupling reactions and is often employed as a precursor in the synthesis of more complex organic molecules. Additionally, its ability to form stable siloxane bonds makes it valuable in the development of silicone-based materials. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H14Si
InChI:InChI=1/C11H14Si/c1-12(2,3)10-9-11-7-5-4-6-8-11/h4-8H,1-3H3
SMILES:C[Si](C)(C)C#Cc1ccccc1
Synonyms:- 1-Phenyl-2-(trimethylsilyl)acetylene
- Trimethyl(Phenylethynyl)Silane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Phenyl-2-trimethylsilylacetylene, 99%
CAS:1-Phenyl-2-trimethylsilylacetylene was used in the preparation of donor-stabilized Pt--alkyne complexes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa AFormula:C11H14SiPurity:99%Color and Shape:Colorless to yellow, LiquidMolecular weight:174.32Trimethyl(Phenylethynyl)Silane
CAS:Trimethyl(Phenylethynyl)SilaneFormula:C11H14SiPurity:98%Molecular weight:174.31Benzene, [2-(trimethylsilyl)ethynyl]-
CAS:Formula:C11H14SiPurity:95%Color and Shape:LiquidMolecular weight:174.3144Trimethyl(phenylethynyl)silane
CAS:Trimethyl(phenylethynyl)silaneFormula:C11H14SiPurity:95%Molecular weight:174.31Phenylethynyl trimethylsilane
CAS:S13470 - Phenylethynyl trimethylsilane
Formula:C11H14SiPurity:95%Color and Shape:ClearMolecular weight:174.3181-Phenyl-2-(trimethylsilyl)acetylene
CAS:Formula:C11H14SiPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:174.32





