CAS 21743-75-9
:Tetrazole-5-acetic acid
Description:
Tetrazole-5-acetic acid is a heterocyclic organic compound characterized by the presence of a tetrazole ring, which consists of four nitrogen atoms and one carbon atom in a five-membered ring structure. This compound features an acetic acid functional group, contributing to its acidic properties. Tetrazole-5-acetic acid is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals and agrochemicals. It exhibits good solubility in polar solvents, making it versatile for various chemical reactions. The presence of both the tetrazole and carboxylic acid functionalities allows for diverse reactivity, including nucleophilic substitutions and coupling reactions. Additionally, tetrazole derivatives are often explored for their biological activities, including antimicrobial and anti-inflammatory properties. Overall, Tetrazole-5-acetic acid is a valuable compound in organic synthesis and drug development, owing to its unique structural features and reactivity.
Formula:C3H4N4O2
InChI:InChI=1S/C3H4N4O2/c8-3(9)1-2-4-6-7-5-2/h1H2,(H,8,9)(H,4,5,6,7)
InChI key:InChIKey=JUNAPQMUUHSYOV-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1NN=NN1
Synonyms:- (1H-Tetrazol-5-yl)acetic acid
- (2H-Tetrazol-5-yl)acetic acid
- 1,2,3,4-Tetrazole-5-acetic acid
- 1H-Tetraazol-5-ylacetic acid
- 1H-Tetrazole-5-acetic acid
- 2-(1H-1,2,3,4-Tetrazol-5-yl)acetic acid
- 2-(1H-Tetrazol-5-yl)acetic acid
- 2-(2H-1,2,3,4-Tetrazol-5-yl)acetic acid
- 2-(2H-Tetrazol-5-yl)acetic acid
- 2H-Tetrazole-5-acetic acid
- 2H-tetrazol-5-ylacetic acid
- NSC 282047
- Tetrazole-5-acetic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Tetrazole-5-acetic Acid
CAS:Formula:C3H4N4O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:128.091H-Tetrazole-5-acetic acid
CAS:1H-Tetrazole-5-acetic acidFormula:C3H4N4O2Purity:95%Molecular weight:128.091H-Tetrazole-5-acetic acid
CAS:Formula:C3H4N4O2Purity:97%Color and Shape:SolidMolecular weight:128.0895(1 H -Tetrazol-5-yl)-acetic acid
CAS:Formula:C3H4N4O2Purity:95.0%Color and Shape:SolidMolecular weight:128.0911H-Tetrazole-5-acetic acid
CAS:1H-Tetrazole-5-acetic acid is a synthetic compound that has been used to produce luminescent gold nanoparticles. It has also been used as a fluorescent probe for the detection of hydrogen chloride gas. 1H-tetrazole-5-acetic acid has been shown to be an effective inhibitor of histone deacetylase, which is involved in regulating gene expression and cellular processes. In high concentrations, this compound can condense into fluorescent products. This chemical’s optical properties have been studied using FTIR spectroscopy and it has been shown to emit light in the visible spectrum at 607 nm when excited by IR beams with a wavelength of 808 nm. 1H-tetrazole-5-acetic acid’s chloride ion is its only charge carrier, making it polar and soluble in water.Formula:C3H4N4O2Purity:Min. 95%Molecular weight:128.09 g/mol




