CymitQuimica logo

CAS 21792-52-9

:

1,2-diethynylbenzene

Description:
1,2-Diethynylbenzene, also known as o-diethynylbenzene, is an organic compound characterized by the presence of two ethynyl groups (-C≡CH) attached to a benzene ring at the 1 and 2 positions. This compound is notable for its unique structure, which contributes to its properties, including its potential use in materials science and organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the ethynyl groups imparts significant reactivity, making it a useful building block in the synthesis of more complex organic molecules. Additionally, 1,2-diethynylbenzene exhibits interesting optical properties, which can be exploited in various applications, including organic light-emitting diodes (OLEDs) and other electronic materials. Due to its unsaturated nature, it can participate in various chemical reactions, such as polymerization and cross-coupling reactions, further expanding its utility in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C10H6
InChI:InChI=1/C10H6/c1-3-9-7-5-6-8-10(9)4-2/h1-2,5-8H
InChI key:CBYDUPRWILCUIC-UHFFFAOYSA-N
SMILES:C#Cc1ccccc1C#C
Synonyms:
  • Benzene, 1,2-Diethynyl-
  • Benzene, diethynyl-
Found 4 products.