CymitQuimica logo

CAS 2180068-12-4

:

4,7-diazatricyclo[7.5.0.02,]tetradeca-1,8-dien-3-one

Description:
4,7-Diazatricyclo[7.5.0.02,7]tetradeca-1,8-dien-3-one is a complex organic compound characterized by its unique bicyclic structure, which includes two nitrogen atoms incorporated into a tricyclic framework. This compound features a conjugated diene system, contributing to its potential reactivity and stability under certain conditions. The presence of the ketone functional group at the 3-position enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic attacks. The diazatricyclic structure may impart interesting properties such as increased rigidity and specific steric effects, which can influence its interactions with other molecules. Additionally, the compound's molecular geometry and electronic configuration can affect its optical properties, making it of interest in fields such as materials science and medicinal chemistry. While specific applications may vary, compounds with similar structures are often explored for their potential in drug development and as intermediates in organic synthesis. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C12H16N2O
InChI:InChI=1S/C12H16N2O/c15-12-11-10-5-3-1-2-4-9(10)8-14(11)7-6-13-12/h8H,1-7H2,(H,13,15)
InChI key:PPUZULGHUONZLS-UHFFFAOYSA-N
SMILES:C1CCC2=CN3CCNC(=O)C3=C2CC1
Synonyms:
  • 3,4,8,9,10,11-hexahydro-2H-cyclohepta[3,4]pyrrolo[1,2-a]pyrazin-1(7H)-one
  • 4,7-diazatricyclo[7.5.0.02,]tetradeca-1,8-dien-3-one
  • 2H-Cyclohepta[3,4]pyrrolo[1,2-a]pyrazin-1(7H)-one, 3,4,8,9,10,11-hexahydro-
Found 3 products.