CymitQuimica logo

CAS 2181-44-4

:

trimethylsulfonium methyl sulfate

Description:
Trimethylsulfonium methyl sulfate, with the CAS number 2181-44-4, is an organic compound characterized by its quaternary ammonium structure. It consists of a central sulfur atom bonded to three methyl groups and a methyl sulfate group, making it a sulfonium salt. This compound is typically a white crystalline solid that is soluble in water and polar organic solvents, which is indicative of its ionic nature. Trimethylsulfonium methyl sulfate is known for its role as a methylating agent in organic synthesis, facilitating the transfer of methyl groups to various substrates. It exhibits stability under standard conditions but may decompose under extreme temperatures or in the presence of strong bases. Additionally, it is used in various applications, including as a reagent in chemical reactions and in the synthesis of other organic compounds. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Overall, trimethylsulfonium methyl sulfate is a versatile compound with significant utility in chemical research and synthesis.
Formula:C4H12O4S2
InChI:InChI=1/C3H9S.CH4O4S/c1-4(2)3;1-5-6(2,3)4/h1-3H3;1H3,(H,2,3,4)/q+1;/p-1
InChI key:ANXKZXRDXAZQJT-UHFFFAOYSA-M
SMILES:COS(=O)(=O)[O-].C[S+](C)C
Found 4 products.