CymitQuimica logo

CAS 218608-95-8

:

Boc-(S)-3-amino-4-(2-chloro-phenyl)-butyric acid

Description:
Boc-(S)-3-amino-4-(2-chloro-phenyl)-butyric acid is a chemical compound characterized by its structure, which includes a butyric acid backbone with an amino group and a Boc (tert-butyloxycarbonyl) protecting group. The presence of the 2-chlorophenyl substituent introduces a halogenated aromatic ring, which can influence the compound's reactivity and biological activity. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to serve as a building block for more complex molecules. The Boc group is commonly employed to protect amine functionalities during synthetic procedures, allowing for selective reactions. The (S) configuration indicates that the amino acid is in the S-enantiomeric form, which is often relevant in biological contexts, as the chirality can affect the compound's interaction with biological systems. Overall, Boc-(S)-3-amino-4-(2-chloro-phenyl)-butyric acid is a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals.
Formula:C15H20ClNO4
InChI:InChI=1/C15H20ClNO4/c1-15(2,3)21-14(20)17-11(9-13(18)19)8-10-6-4-5-7-12(10)16/h4-7,11H,8-9H2,1-3H3,(H,17,20)(H,18,19)/t11-/m0/s1
InChI key:UBRPCCFLMVZEKN-NSHDSACASA-N
SMILES:CC(C)(C)OC(=N[C@@H](Cc1ccccc1Cl)CC(=O)O)O
Synonyms:
  • (3S)-3-[(tert-butoxycarbonyl)amino]-4-(2-chlorophenyl)butanoic acid
  • Boc-β-HoPhe(2-Cl)-OH
Found 2 products.