CAS 21861-32-5
:6-hydroxy-4-methyl-1-benzofuran-3(2H)-one
Description:
6-Hydroxy-4-methyl-1-benzofuran-3(2H)-one, with the CAS number 21861-32-5, is a chemical compound that belongs to the class of benzofurans, which are characterized by a fused benzene and furan ring structure. This particular compound features a hydroxyl group (-OH) at the 6-position and a methyl group (-CH3) at the 4-position of the benzofuran ring, contributing to its unique chemical properties. It is known for its potential biological activities, including antioxidant and anti-inflammatory properties, which have garnered interest in pharmaceutical research. The presence of the hydroxyl group enhances its solubility in polar solvents, while the methyl group may influence its lipophilicity and overall reactivity. Additionally, the compound's structure allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.
Formula:C9H8O3
InChI:InChI=1/C9H8O3/c1-5-2-6(10)3-8-9(5)7(11)4-12-8/h2-3,10H,4H2,1H3
InChI key:JANZWCJQQFVOPT-UHFFFAOYSA-N
SMILES:Cc1cc(cc2c1C(=O)CO2)O
Synonyms:- 3(2H)-benzofuranone, 6-hydroxy-4-methyl-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
