CymitQuimica logo

CAS 218624-29-4

:

2H-Thiopyran-4-acetic acid, tetrahydro-, ethyl ester

Description:
2H-Thiopyran-4-acetic acid, tetrahydro-, ethyl ester is a chemical compound characterized by its unique thiopyran ring structure, which incorporates a sulfur atom into a six-membered ring containing five carbon atoms. This compound features an acetic acid moiety, indicating the presence of a carboxylic acid functional group, which is esterified with an ethyl group. The tetrahydro configuration suggests that the compound is saturated, contributing to its stability and potentially influencing its reactivity. The presence of the thiopyran ring may impart specific biological or chemical properties, making it of interest in various fields, including medicinal chemistry and materials science. The compound's molecular structure allows for potential interactions with biological systems, which could lead to applications in pharmaceuticals or agrochemicals. Additionally, its CAS number, 218624-29-4, serves as a unique identifier for regulatory and research purposes, facilitating the study and application of this compound in various scientific contexts.
Formula:C9H16O2S
InChI:InChI=1S/C9H16O2S/c1-2-11-9(10)7-8-3-5-12-6-4-8/h8H,2-7H2,1H3
InChI key:WGKQUBVOAJZQCS-UHFFFAOYSA-N
SMILES:CCOC(=O)CC1CCSCC1
Found 5 products.