CAS 218632-36-1
:ETHYL 1-(4-METHOXYPHENYL)-3-METHYL-1H-PYRAZOLE-5-CARBOXYLATE
Description:
Ethyl 1-(4-methoxyphenyl)-3-methyl-1H-pyrazole-5-carboxylate, with the CAS number 218632-36-1, is a chemical compound characterized by its pyrazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a 4-methoxyphenyl substituent enhances its potential for biological activity, as aromatic rings often play a crucial role in interactions with biological targets. The methyl group at the 3-position of the pyrazole ring can influence the compound's steric and electronic properties, potentially affecting its pharmacological profile. Ethyl 1-(4-methoxyphenyl)-3-methyl-1H-pyrazole-5-carboxylate may exhibit various properties such as moderate to high lipophilicity, which can impact its absorption and distribution in biological systems. Overall, this compound is of interest in medicinal chemistry and may be explored for its potential therapeutic applications, although specific biological activities would require further investigation.
Formula:C14H16N2O3
InChI:InChI=1S/C14H16N2O3/c1-4-19-14(17)13-9-10(2)15-16(13)11-5-7-12(18-3)8-6-11/h5-9H,4H2,1-3H3
InChI key:JMULFDKDMXDQJB-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC(=NN1C2=CC=C(C=C2)OC)C
Synonyms:- Buttpark 85\18-77
- 1-(4-Methoxyphenyl)-3-Methyl-1H-Pyrazole-5-Carboxylate
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethyl 1-(4-methoxyphenyl)-3-methyl-1H-pyrazole-5-carboxylate
CAS:Formula:C14H16N2O3Molecular weight:260.2884
