CAS 21868-41-7
:4-(chloromethyl)-6-(morpholin-4-yl)-1,3,5-triazin-2-amine
Description:
4-(Chloromethyl)-6-(morpholin-4-yl)-1,3,5-triazin-2-amine, with the CAS number 21868-41-7, is a chemical compound characterized by its triazine core, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features a chloromethyl group, which enhances its reactivity, and a morpholine moiety, contributing to its potential biological activity. The presence of the amino group at the triazine position indicates that it can participate in various chemical reactions, such as nucleophilic substitutions. This compound may exhibit properties relevant to pharmaceuticals or agrochemicals, given its structural features that allow for interactions with biological systems. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Overall, the unique combination of functional groups in this compound suggests potential utility in medicinal chemistry and material science.
Formula:C8H12ClN5O
InChI:InChI=1/C8H12ClN5O/c9-5-6-11-7(10)13-8(12-6)14-1-3-15-4-2-14/h1-5H2,(H2,10,11,12,13)
SMILES:C1COCCN1c1nc(CCl)nc(=N)[nH]1
Synonyms:- 1,3,5-Triazin-2-amine, 4-(chloromethyl)-6-(4-morpholinyl)-
- 4-(Chloromethyl)-6-(morpholin-4-yl)-1,3,5-triazin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(chloromethyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine
CAS:Formula:C8H12ClN5OMolecular weight:229.6668
