CAS 2187-07-7

(±)-2-Aminooctanoic acid

Description:

(±)-2-Aminooctanoic acid, also known as 2-aminooctanoic acid, is an amino acid characterized by its aliphatic chain and the presence of an amino group (-NH2) and a carboxylic acid group (-COOH). This compound has a molecular formula of C8H17NO2, indicating it contains eight carbon atoms, seventeen hydrogen atoms, one nitrogen atom, and two oxygen atoms. It exists as a racemic mixture, meaning it contains equal amounts of both enantiomers, which can exhibit different biological activities. The presence of the amino group makes it a basic compound, while the carboxylic acid group contributes to its acidic properties. This amino acid is soluble in water, which is typical for amino acids due to their polar functional groups. (±)-2-Aminooctanoic acid is of interest in biochemical research and may have applications in the synthesis of peptides or as a building block in organic chemistry. Its structural features allow it to participate in various chemical reactions, making it a versatile compound in both synthetic and biological contexts.

Formula: C₈H₁₇NO₂

InChI: InChI=1S/C8H17NO2/c1-2-3-4-5-6-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11)

InChI key: InChIKey=AKVBCGQVQXPRLD-UHFFFAOYSA-N

SMILES: C(CCCCCC)(C(O)=O)N

Synonyms:

• 2-Aminooctanoic acid
• 2-Amino-DL-caprylic acid
• Octanoic acid, 2-amino-, DL-
• Octanoic acid, 2-amino-
• Octanoic acid, 2-amino-, (±)-

DL-2-Aminooctanoic acid

CAS: 2187-07-7

Formula: C₈H₁₇NO₂

Molecular weight: 159.2261

Ref: IN-DA003PSP