CymitQuimica logo

CAS 218929-27-2

:

4-fluorophenyl 3-(trifluoromethyl)benzoate

Description:
4-Fluorophenyl 3-(trifluoromethyl)benzoate is an organic compound characterized by its aromatic structure, which includes a fluorinated phenyl group and a trifluoromethyl substituent. This compound features a benzoate functional group, indicating that it is an ester derived from benzoic acid. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The fluorine atoms in both the 4-fluorophenyl and trifluoromethyl groups contribute to the compound's unique electronic properties, potentially affecting its interactions in chemical reactions and biological systems. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in drug design and as a building block in synthetic chemistry. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Safety data and handling precautions should be considered, as fluorinated compounds can exhibit unique toxicological profiles.
Formula:C14H8F4O2
InChI:InChI=1/C14H8F4O2/c15-11-4-6-12(7-5-11)20-13(19)9-2-1-3-10(8-9)14(16,17)18/h1-8H
InChI key:FDOAXLUDEAKGGJ-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)C(F)(F)F)C(=O)Oc1ccc(cc1)F
Synonyms:
  • Benzoic Acid, 3-(Trifluoromethyl)-, 4-Fluorophenyl Ester
Found 2 products.