CymitQuimica logo

CAS 218929-90-9

:

N-(4-amino-2-chloro-6-fluorophenyl)acetamide

Description:
N-(4-amino-2-chloro-6-fluorophenyl)acetamide, with the CAS number 218929-90-9, is a chemical compound characterized by its amide functional group, which is linked to an aromatic ring. This compound features a substituted phenyl group, where the presence of amino, chloro, and fluoro substituents contributes to its unique chemical properties. The amino group (-NH2) typically enhances the compound's solubility in polar solvents and may participate in hydrogen bonding, while the chloro and fluoro substituents can influence its reactivity and stability. The presence of these halogen atoms often affects the compound's electronic properties, potentially making it a candidate for various biological activities. Additionally, the acetamide moiety suggests potential applications in medicinal chemistry, as amides are common in drug design. Overall, this compound's structural characteristics may lead to interesting interactions in biological systems, warranting further investigation for potential therapeutic uses.
Formula:C8H8ClFN2O
InChI:InChI=1/C8H8ClFN2O/c1-4(13)12-8-6(9)2-5(11)3-7(8)10/h2-3H,11H2,1H3,(H,12,13)
SMILES:CC(=Nc1c(cc(cc1F)N)Cl)O
Found 1 products.