CymitQuimica logo

CAS 218962-77-7

:

H-p-Carboxy-Phe(OtBu)-OH

Description:
H-p-Carboxy-Phe(OtBu)-OH, also known by its CAS number 218962-77-7, is a chemical compound that belongs to the class of amino acids and derivatives. It features a carboxylic acid functional group, which is characteristic of amino acids, and a tert-butyl (OtBu) group attached to the phenyl ring, enhancing its hydrophobic properties. This compound is typically used in peptide synthesis and as a building block in organic chemistry due to its ability to participate in various reactions, including coupling reactions. The presence of the carboxylic acid group allows for the formation of amide bonds, making it valuable in the development of pharmaceuticals and biologically active compounds. Additionally, the tert-butyl group can provide steric hindrance, influencing the reactivity and selectivity of the compound in synthetic pathways. Overall, H-p-Carboxy-Phe(OtBu)-OH is significant in research and industrial applications, particularly in the fields of medicinal chemistry and biochemistry.
Formula:C14HNO4
InChI:InChI=1S/C14H19NO4/c1-14(2,3)19-13(18)10-6-4-9(5-7-10)8-11(15)12(16)17/h4-7,11H,8,15H2,1-3H3,(H,16,17)/t11-/m0/s1
InChI key:KDWYFVGLKNKOMV-NSHDSACASA-N
SMILES:CC(C)(C)OC(=O)C1=CC=C(C=C1)C[C@@H](C(=O)O)N
Found 4 products.