CymitQuimica logo

CAS 21902-41-0

:

1,3,7-trichloroisoquinoline

Description:
1,3,7-Trichloroisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of three chlorine atoms at the 1, 3, and 7 positions of the isoquinoline ring significantly influences its chemical properties, including its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit a pale yellow to brown color. It is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various organic compounds. The chlorinated nature of the molecule can enhance its biological activity, making it of interest in pharmaceutical research. However, due to the presence of chlorine, it may also exhibit toxicity and environmental persistence, necessitating careful handling and disposal. As with many chlorinated compounds, it is important to consider its behavior in biological systems and its potential effects on human health and the environment.
Formula:C9H4Cl3N
InChI:InChI=1S/C9H4Cl3N/c10-6-2-1-5-3-8(11)13-9(12)7(5)4-6/h1-4H
InChI key:QGFGUSGNXGWHNY-UHFFFAOYSA-N
SMILES:C1=CC(=CC2=C(N=C(C=C21)Cl)Cl)Cl
Synonyms:
  • Isoquinoline, 1,3,7-trichloro-
Found 2 products.