CymitQuimica logo

CAS 21905-78-2

:

N-Acetyl-2-oxindole

Description:
N-Acetyl-2-oxindole is an organic compound characterized by its oxindole structure, which features a bicyclic framework consisting of a benzene ring fused to a pyrrolidine ring. The presence of the acetyl group at the nitrogen atom enhances its solubility in organic solvents and contributes to its reactivity. This compound is often studied for its potential biological activities, including anti-inflammatory and anticancer properties, making it of interest in medicinal chemistry. N-Acetyl-2-oxindole exhibits moderate polarity, which can influence its interaction with biological targets. Its molecular structure allows for various functionalizations, making it a versatile intermediate in organic synthesis. Additionally, it may participate in hydrogen bonding due to the presence of the carbonyl and amine functionalities, affecting its physical properties such as melting point and boiling point. Overall, N-Acetyl-2-oxindole serves as a valuable compound in both research and pharmaceutical applications, with ongoing studies exploring its full potential in drug development.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c1-7(12)11-9-5-3-2-4-8(9)6-10(11)13/h2-5H,6H2,1H3
InChI key:NRWLXCRLJQEJHE-UHFFFAOYSA-N
SMILES:CC(=O)N1c2ccccc2CC1=O
Synonyms:
  • 1-Acetyloxindole
  • 1-acetyl-1,3-dihydro-2H-indol-2-one
Found 3 products.