CymitQuimica logo

CAS 21908-10-1

:

Ethyl 6-formyl-2-pyridinecarboxylate

Description:
Ethyl 6-formyl-2-pyridinecarboxylate, with the CAS number 21908-10-1, is an organic compound that features a pyridine ring substituted with both an ethyl ester and an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the aldehyde group contributes to its reactivity, making it susceptible to oxidation and condensation reactions. Ethyl 6-formyl-2-pyridinecarboxylate is often utilized in organic synthesis, particularly in the preparation of various heterocyclic compounds and as an intermediate in pharmaceutical chemistry. Its unique structure allows for potential applications in medicinal chemistry, where modifications can lead to compounds with biological activity. Additionally, the compound's stability under standard laboratory conditions makes it a valuable reagent in synthetic organic chemistry.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c1-2-13-9(12)8-5-3-4-7(6-11)10-8/h3-6H,2H2,1H3
InChI key:InChIKey=PILDWRGFGKVUSE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C(C=O)C=CC1
Synonyms:
  • Picolinic acid, 6-formyl-, ethyl ester
  • 2-Pyridinecarboxylic acid, 6-formyl-, ethyl ester
  • Ethyl 6-formylpicolinate
  • Ethyl 6-formyl-2-pyridinecarboxylate
Found 3 products.