CymitQuimica logo

CAS 21909-49-9

:

ethyl (2-methyl-1H-indol-3-yl)acetate

Description:
Ethyl (2-methyl-1H-indol-3-yl)acetate, with the CAS number 21909-49-9, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an ethyl acetate functional group, contributing to its ester classification. Ethyl (2-methyl-1H-indol-3-yl)acetate is typically a colorless to pale yellow liquid with a pleasant, fruity odor, making it potentially useful in flavor and fragrance applications. It is moderately soluble in organic solvents and exhibits low solubility in water due to its hydrophobic indole moiety. The compound may also exhibit biological activity, as many indole derivatives are known for their pharmacological properties. Its synthesis often involves the reaction of indole derivatives with acetic acid or its derivatives, highlighting its relevance in organic synthesis and medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential health and environmental impacts.
Formula:C13H15NO2
InChI:InChI=1/C13H15NO2/c1-3-16-13(15)8-11-9(2)14-12-7-5-4-6-10(11)12/h4-7,14H,3,8H2,1-2H3
InChI key:SLEXJGHKKHQSDC-UHFFFAOYSA-N
SMILES:CCOC(=O)Cc1c(C)[nH]c2ccccc12
Found 4 products.