CymitQuimica logo

CAS 21912-27-6

:

Ethanol, 2,2'-[methylenebis(oxy)]bis-, diacetate

Description:
Ethanol, 2,2'-[methylenebis(oxy)]bis-, diacetate, commonly known as diacetate of bis(2-hydroxyethyl) ether, is an organic compound characterized by its ester functional groups. It is a colorless, viscous liquid with a sweet, fruity odor, often used as a solvent or in the formulation of various products, including coatings and adhesives. The compound features two acetate groups attached to a central methylene bridge, which contributes to its solubility in organic solvents and moderate polarity. Its molecular structure allows for hydrogen bonding, enhancing its interactions with other polar substances. Ethanol diacetate is generally stable under normal conditions but may undergo hydrolysis in the presence of water or strong acids, leading to the release of acetic acid and ethanol. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes. Proper storage in a cool, well-ventilated area away from heat sources is recommended to maintain its integrity and prevent degradation.
Formula:C9H16O6
InChI:InChI=1S/C9H16O6/c1-8(10)14-5-3-12-7-13-4-6-15-9(2)11/h3-7H2,1-2H3
InChI key:ZHAHEJYDNRZNGZ-UHFFFAOYSA-N
SMILES:CC(=O)OCCOCOCCOC(=O)C
Found 1 products.