CAS 219138-02-0

L-a-Asparagine,N-[(phenylmethoxy)carbonyl]-L-isoleucyl-L-a-glutamyl-L-threonyl-N-[2-oxo-4-(trifluoromethyl)-2H-1-benzopyran-7-yl]-(9CI)

Description:

The chemical substance known as L-a-Asparagine, N-[(phenylmethoxy)carbonyl]-L-isoleucyl-L-a-glutamyl-L-threonyl-N-[2-oxo-4-(trifluoromethyl)-2H-1-benzopyran-7-yl] (9CI) with CAS number 219138-02-0 is a complex organic compound that features multiple functional groups and a peptide backbone. It is characterized by the presence of amino acids, specifically L-asparagine, L-isoleucine, L-glutamic acid, and L-threonine, which contribute to its biological activity and potential applications in pharmaceuticals. The molecule also contains a phenylmethoxycarbonyl group, enhancing its stability and solubility. Additionally, the presence of a 2-oxo-4-(trifluoromethyl)-2H-1-benzopyran moiety suggests potential interactions with biological targets, possibly influencing its pharmacological properties. The trifluoromethyl group is known for its ability to enhance lipophilicity and metabolic stability. Overall, this compound's unique structure may provide insights into its role in medicinal chemistry and its potential therapeutic applications.

Formula: C₃₇H₄₂F₃N₅O₁₃

InChI: InChI=1S/C37H42F3N5O13/c1-4-18(2)30(45-36(56)57-17-20-8-6-5-7-9-20)34(54)42-24(12-13-27(47)48)32(52)44-31(19(3)46)35(55)43-25(16-28(49)50)33(53)41-21-10-11-22-23(37(38,39)40)15-29(51)58-26(22)14-21/h5-11,14-15,18-19,24-25,30-31,46H,4,12-13,16-17H2,1-3H3,(H,41,53)(H,42,54)(H,43,55)(H,44,52)(H,45,56)(H,47,48)(H,49,50)/t18-,19+,24-,25-,30-,31-/m0/s1

InChI key: RCIFCAJYIPUCJW-QXPVPWKFSA-N

SMILES: CC[C@H](C)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(=O)O)C(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C(F)(F)F)NC(=O)OCC3=CC=CC=C3

Synonyms:

• Z-Ietd-Afc

Z-IETD-AFC

CAS: 219138-02-0

Z-IETD-AFC

Formula: C₃₇H₄₂F₃N₅O₁₃

Purity: 99.5%

Molecular weight: 821.75

Ref: 54-BUP02520

Z-IETD-AFC

CAS: 219138-02-0

Z-IETD-AFC is a fluorescent substrate for caspase-8 and granzyme B. It can be used to quantify cysteinyl aspartate-8 or granzyme B activity.

Formula: C₃₇H₄₂F₃N₅O₁₃

Purity: 99.71%

Color and Shape: Solid

Molecular weight: 821.7503

Ref: TM-T36333

Z-Ile-Glu-Thr-Asp 7-amido-4-trifluoromethylcoumarin

CAS: 219138-02-0

Formula: C₃₇H₄₂F₃N₅O₁₃

Molecular weight: 821.75

Ref: 7W-GK0767

Z-IETD-AFC

CAS: 219138-02-0

Formula: C₃₇H₄₂F₃N₅O₁₃

Molecular weight: 821.7503

Ref: IN-DA00BCRV

Caspase substrate

CAS: 219138-02-0

Caspase substrates are a class of pharmacological agents that regulate apoptosis. Caspases are proteases that cleave specific proteins in the cell, leading to apoptosis. Pro-apoptotic proteins activate caspases, while anti-apoptotic proteins inhibit them. Caspase substrates can be either pro-caspase or anti-caspase, depending on the desired effect. They may also be used to regulate caspases without affecting their activity. The caspase substrate is cleaved by caspases and releases a polypeptide fragment that triggers apoptosis in some cells, but not others. For example, the Hl-60 cell line is resistant to the pro-apoptotic effects of the substrate because it contains an anti-apoptotic protein called Bcl-2. In contrast, myocardial cells contain pro-apoptotic proteins and are sensitive to the pro-apoptotic effects of the substrate. In

Purity: Min. 95%

Molecular weight: 821.75 g/mol

Ref: 3D-EC58694