CymitQuimica logo

CAS 21915-53-7

:

3-Phenyl-2-oxiranemethanol

Description:
3-Phenyl-2-oxiranemethanol, identified by its CAS number 21915-53-7, is an organic compound characterized by the presence of an epoxide functional group and a phenyl substituent. The structure features a three-membered cyclic ether (the oxirane) that is attached to a hydroxymethyl group, contributing to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its epoxide functionality makes it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals, as it can undergo ring-opening reactions with nucleophiles. Additionally, the presence of the phenyl group may impart unique properties, such as increased stability and potential for π-π interactions. The compound's reactivity, solubility, and stability can vary based on environmental conditions, such as temperature and pH. Overall, 3-Phenyl-2-oxiranemethanol is of interest in both academic research and industrial applications due to its versatile chemical behavior.
Formula:C9H10O2
InChI:InChI=1S/C9H10O2/c10-6-8-9(11-8)7-4-2-1-3-5-7/h1-5,8-10H,6H2
InChI key:InChIKey=PVALSANGMFRTQM-UHFFFAOYSA-N
SMILES:C(O)C1C(O1)C2=CC=CC=C2
Synonyms:
  • 3-Phenyl-2-oxiranemethanol
  • Oxiranemethanol, 3-phenyl-
  • 2,3-Epoxy-1-hydroxy-3-phenylpropane
  • 1-Propanol, 2,3-epoxy-3-phenyl-
  • 2-Oxiranemethanol, 3-phenyl-
Found 4 products.