CymitQuimica logo

CAS 21917-88-4

:

6,7-Dihydro-5H-isoquinolin-8-one

Description:
6,7-Dihydro-5H-isoquinolin-8-one, with the CAS number 21917-88-4, is a bicyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carbonyl group (ketone) at the 8-position and a saturated nitrogen-containing ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitrogen atom in the ring can impart basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a precursor in pharmaceutical formulations. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H9NO
InChI:InChI=1/C9H9NO/c11-9-3-1-2-7-4-5-10-6-8(7)9/h4-6H,1-3H2
InChI key:WFZAOWUFFCIBNP-UHFFFAOYSA-N
SMILES:C1Cc2ccncc2C(=O)C1
Synonyms:
  • 8(5H)-Isoquinolinone, 6,7-dihydro-
  • 6,7-dihydroisoquinolin-8(5H)-one
Found 4 products.