CymitQuimica logo

CAS 21947-97-7

:

Boc-Cys(Dpm)-OH

Description:
Boc-Cys(Dpm)-OH, with the CAS number 21947-97-7, is a protected form of the amino acid cysteine, which is notable for its thiol (-SH) group that plays a crucial role in protein structure and function. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group used in peptide synthesis to prevent unwanted reactions at the amino group. The "Dpm" (diphenylmethyl) group is another protective moiety that shields the thiol group, enhancing the stability of the compound during synthesis. This compound is typically utilized in peptide synthesis and research involving cysteine derivatives, allowing for the selective modification of the thiol group after the desired peptide sequence has been assembled. Its characteristics include being a white to off-white solid, soluble in organic solvents, and relatively stable under standard laboratory conditions. The presence of the Boc and Dpm groups makes it a versatile intermediate in the synthesis of more complex peptides and proteins, facilitating the study of cysteine's role in biological systems.
Formula:C21H25NO4S
InChI:InChI=1S/C21H25NO4S/c1-21(2,3)26-20(25)22-17(19(23)24)14-27-18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17-18H,14H2,1-3H3,(H,22,25)(H,23,24)/t17-/m0/s1
InChI key:AMTHPOXIVDHMLZ-KRWDZBQOSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CSC(C1=CC=CC=C1)C2=CC=CC=C2)C(=O)O
Found 4 products.