CymitQuimica logo

CAS 219508-19-7

:

3-bromo-1H-indole-6-carboxylic acid

Description:
3-Bromo-1H-indole-6-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 3-position and a carboxylic acid group at the 6-position contributes to its unique reactivity and properties. This compound typically appears as a solid and is soluble in polar solvents, reflecting the influence of the carboxylic acid group. It is often used in organic synthesis and medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. The bromine substituent can facilitate further chemical modifications, making it a versatile intermediate in various synthetic pathways. Additionally, the compound may exhibit specific interactions with biological targets, which can be explored in drug discovery research. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C9H6BrNO2
InChI:InChI=1/C9H6BrNO2/c10-7-4-11-8-3-5(9(12)13)1-2-6(7)8/h1-4,11H,(H,12,13)
InChI key:XZNVEIYDUGPMCS-UHFFFAOYSA-N
SMILES:c1cc2c(c[nH]c2cc1C(=O)O)Br
Synonyms:
  • 1H-Indole-6-carboxylic acid, 3-bromo-
  • 3-Bromo-1H-indole-6-carboxylicacid
Found 4 products.