CymitQuimica logo

CAS 219508-62-0

:

1-Boc-6-aminoindole

Description:
1-Boc-6-aminoindole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The "1-Boc" designation indicates the presence of a tert-butyloxycarbonyl (Boc) protecting group at the nitrogen atom of the indole, which is commonly used in organic synthesis to protect amines during chemical reactions. The "6-amino" part signifies that there is an amino group (-NH2) attached to the sixth position of the indole ring. This compound is typically utilized in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals, due to its potential biological activity and ability to serve as a building block for more complex molecules. Its properties include moderate solubility in organic solvents and stability under standard laboratory conditions, although it may be sensitive to moisture and air. As with many organic compounds, proper handling and storage are essential to maintain its integrity and reactivity.
Formula:C13H16N2O2
InChI:InChI=1/C13H16N2O2/c1-13(2,3)17-12(16)15-7-6-9-4-5-10(14)8-11(9)15/h4-8H,14H2,1-3H3
InChI key:KYZMFSVVFOVRNK-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)N
Synonyms:
  • tert-Butyl 6-amino-1-indolecarboxylate
  • tert-butyl 6-amino-1H-indole-1-carboxylate
Found 5 products.