CymitQuimica logo

CAS 219533-65-0

:

7-Aminoflunitrazepam-d3 (N-methyl-d3)

Description:
7-Aminoflunitrazepam-d3 (N-methyl-d3) is a deuterated derivative of 7-aminoflunitrazepam, which is a metabolite of the benzodiazepine flunitrazepam. This compound is characterized by the presence of deuterium atoms, which are isotopes of hydrogen, replacing certain hydrogen atoms in the molecular structure. The incorporation of deuterium enhances the stability and alters the pharmacokinetic properties of the compound, making it useful in research applications, particularly in studies involving drug metabolism and pharmacology. As a benzodiazepine derivative, it exhibits properties such as anxiolytic, sedative, and muscle relaxant effects, although its specific biological activity may differ from its non-deuterated counterparts. The compound is typically used in scientific research, particularly in the development of analytical methods for detecting benzodiazepines in biological samples. Its CAS number, 219533-65-0, uniquely identifies this specific chemical substance in chemical databases, facilitating its identification and study in various scientific contexts.
Formula:C16H14FN3O
InChI:InChI=1S/C16H14FN3O/c1-20-14-7-6-10(18)8-12(14)16(19-9-15(20)21)11-4-2-3-5-13(11)17/h2-8H,9,18H2,1H3/i1D3
InChI key:LTCDLGUFORGHGY-FIBGUPNXSA-N
SMILES:[2H]C([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)N)C3=CC=CC=C3F
Synonyms:
  • 7-Aminoflunitrazepam D3
  • 7-Aminoflunitrazepam-d3 (N-methyl-d3)
Found 3 products.