CAS 219537-88-9
:4-(Phenylethynyl)phthalic acid
Description:
4-(Phenylethynyl)phthalic acid, with the CAS number 219537-88-9, is an organic compound characterized by its phthalic acid core modified with a phenylethynyl group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and materials science, particularly in the development of polymers and dyes. The presence of the phenylethynyl group enhances its reactivity and solubility in organic solvents, making it useful in various chemical reactions, including cross-coupling reactions. The compound exhibits functional groups that can participate in hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, its structure allows for potential interactions with biological systems, which may be of interest in medicinal chemistry. Overall, 4-(Phenylethynyl)phthalic acid is a versatile compound with significant implications in both industrial and research settings.
Formula:C16H10O4
InChI:InChI=1/C16H10O4/c17-15(18)13-9-8-12(10-14(13)16(19)20)7-6-11-4-2-1-3-5-11/h1-5,8-10H,(H,17,18)(H,19,20)
InChI key:InChIKey=JPVBXQAUQXVQGJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)C=CC(C#CC2=CC=CC=C2)=C1
Synonyms:- 1,2-Benzenedicarboxylic acid, 4-(2-phenylethynyl)-
- 4-(Phenylethynyl)phthalic acid
- 4-(Phenylethynyl)phthalic acid
- 1,2-Benzenedicarboxylic acid, 4-(phenylethynyl)-
- 4-(2-Phenylethynyl)-1,2-benzenedicarboxylic acid
- 1,2-benzenedicarboxylic acid, 4-(2-phenylethynyl)-
- 4-PHENYLETHYNYLPHTHALIC ACID
- 4-Phenylethynylphthalic acid ,98%
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
