CAS 2196-14-7: 7,4′-Dihydroxyflavone
Description:7,4′-Dihydroxyflavone, with the CAS number 2196-14-7, is a flavonoid compound characterized by its two hydroxyl groups located at the 7 and 4' positions of the flavone backbone. This compound exhibits a yellow to orange color, typical of flavonoids, and is soluble in organic solvents like ethanol and methanol, but less soluble in water. It is known for its antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and neuroprotective effects. Additionally, 7,4′-Dihydroxyflavone has been studied for its ability to modulate various biological pathways, including those involved in cell signaling and apoptosis. Its structural features allow it to interact with various enzymes and receptors, making it a subject of interest in pharmacological research. The compound is often investigated in the context of natural products and herbal medicine, given its presence in various plant species. Overall, 7,4′-Dihydroxyflavone represents a significant compound in the study of flavonoids and their applications in health and disease.
Formula:C15H10O4
InChI:InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-8,16-17H
InChI key:InChIKey=LCAWNFIFMLXZPQ-UHFFFAOYSA-N
SMILES:O=C1C=C(OC2=CC(O)=CC=C12)C=3C=CC(O)=CC3
- Synonyms:
- 2196-14-7
- 4H-1-Benzopyran-4-one, 7-hydroxy-2-(4-hydroxyphenyl)-
- 4′,7-Dihydroxyflavone
- 7,4′-Dihydroxyflavone
- 7-Hydroxy-2-(4-Hydroxyphenyl)chromen-4-one
- 7-Hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- Flavone, 4′,7-dihydroxy-
- Kumatakenin B
- 7-Hydroxy-2-(4-hydroxyphényl)-4H-chromén-4-one
- 7-Hydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one
- See more synonyms
