
CAS 219655-57-9
:GUANIDINYL NALTRINDOLE
Description:
Guanidinyl naltrindole is a synthetic compound that belongs to the class of opioid receptor antagonists. It is primarily characterized by its guanidine functional group, which contributes to its pharmacological properties. This compound is known for its selective antagonism at the delta-opioid receptor, making it of interest in research related to pain management and addiction. The structure of guanidinyl naltrindole allows it to interact with the opioid system, potentially influencing analgesic pathways without the typical side effects associated with opioid agonists. Its unique chemical properties may also provide insights into the development of new therapeutic agents aimed at treating opioid dependence or other related disorders. As with many synthetic compounds, the safety profile, efficacy, and potential side effects are subjects of ongoing research. Overall, guanidinyl naltrindole represents a significant area of study within medicinal chemistry and pharmacology, particularly in the context of opioid receptor modulation.
Formula:C31H31F6N5O7
InChI:InChI=1S/C27H29N5O3.2C2HF3O2/c28-25(29)30-15-4-5-18-16(10-15)17-11-27(34)20-9-14-3-6-19(33)23-21(14)26(27,24(35-23)22(17)31-18)7-8-32(20)12-13-1-2-13;2*3-2(4,5)1(6)7/h3-6,10,13,20,24,31,33-34H,1-2,7-9,11-12H2,(H4,28,29,30);2*(H,6,7)/t20-,24+,26+,27-;;/m1../s1
InChI key:LGXCKWXJRPYRLW-AWCPWCJTSA-N
SMILES:C1CC1CN2CC[C@]34[C@@H]5C6=C(C[C@]3([C@H]2CC7=C4C(=C(C=C7)O)O5)O)C8=C(N6)C=CC(=C8)N=C(N)N.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O
Synonyms:- 5’Guanidinonaltrindole Bis(Trifluoroacetate)
- 5μ-Guanidinonaltrindole hydrate di(trifluoroacetate) salt
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
5′-Guanidinonaltrindole Bis(trifluoroacetate) Salt
CAS:Controlled ProductFormula:C27H29N5O3•2(C2HF3O2)Color and Shape:NeatMolecular weight:585.2199GNTI TFA
CAS:GNTI TFA is a selective kappa opioid receptor antagonist.Formula:C31H31F6N5O7Color and Shape:SolidMolecular weight:699.60


