CymitQuimica logo

CAS 219667-41-1

:

Methanesulfonic acid, 1,1,1-trifluoro-, 3,5-dimethylphenyl ester

Description:
Methanesulfonic acid, 1,1,1-trifluoro-, 3,5-dimethylphenyl ester, identified by CAS number 219667-41-1, is an organic compound characterized by its ester functional group derived from methanesulfonic acid and a trifluoromethyl-substituted aromatic ring. This compound typically exhibits properties associated with both sulfonic acids and esters, such as high solubility in polar solvents and potential reactivity due to the presence of the trifluoromethyl group, which can influence its electronic properties and stability. The 3,5-dimethylphenyl moiety contributes to its hydrophobic characteristics, potentially affecting its behavior in various chemical environments. Methanesulfonic acid derivatives are often utilized in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group can enhance the lipophilicity and metabolic stability of the compound, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as compounds with sulfonic acid and trifluoromethyl groups can pose specific health and environmental risks.
Formula:C9H9F3O3S
InChI:InChI=1S/C9H9F3O3S/c1-6-3-7(2)5-8(4-6)15-16(13,14)9(10,11)12/h3-5H,1-2H3
InChI key:AKQLMFGQYJCFAN-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1)OS(=O)(=O)C(F)(F)F)C
Synonyms:
  • 3,5-Dimethylphenyl Trifluoromethanesulfonate
  • Methanesulfonic acid, 1,1,1-trifluoro-, 3,5-dimethylphenyl ester
  • 5-(Trifluoromethylsulfonyloxy)-m-xylene
Found 3 products.