CymitQuimica logo

CAS 219686-43-8

:

2H-1,5-Benzodiazepin-2-one, 7-bromo-1,3,4,5-tetrahydro-

Description:
2H-1,5-Benzodiazepin-2-one, 7-bromo-1,3,4,5-tetrahydro- is a chemical compound belonging to the benzodiazepine class, characterized by its fused benzene and diazepine rings. This compound features a bromine substituent at the 7-position, which can influence its biological activity and pharmacological properties. The presence of the tetrahydro structure indicates that it has a saturated ring system, which may affect its reactivity and stability. Benzodiazepines are known for their psychoactive effects, often acting as anxiolytics, sedatives, or anticonvulsants, although the specific activity of this compound would depend on its interaction with various biological targets. The CAS number 219686-43-8 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. As with many benzodiazepines, safety and handling precautions are essential due to potential toxicity and regulatory considerations. Further research would be necessary to fully elucidate its pharmacological profile and potential applications in medicinal chemistry.
Formula:C9H9BrN2O
InChI:InChI=1S/C9H9BrN2O/c10-6-1-2-7-8(5-6)11-4-3-9(13)12-7/h1-2,5,11H,3-4H2,(H,12,13)
InChI key:JFCIBVBVEVBLKR-UHFFFAOYSA-N
SMILES:C1CNC2=C(C=CC(=C2)Br)NC1=O
Found 3 products.