CymitQuimica logo

CAS 21969-12-0

:

1-bromo-4-[(4-nitrophenyl)sulfanyl]benzene

Description:
1-Bromo-4-[(4-nitrophenyl)sulfanyl]benzene, with the CAS number 21969-12-0, is an organic compound characterized by the presence of a bromine atom and a nitrophenyl sulfanyl group attached to a benzene ring. This compound features a bromine substituent at the para position relative to a sulfanyl group that is further substituted with a nitro group on another phenyl ring. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. Additionally, the sulfanyl group can participate in various chemical transformations, including oxidation and substitution reactions. This compound may exhibit moderate to high solubility in organic solvents, while its physical properties, such as melting point and boiling point, would depend on the specific molecular interactions and structural characteristics. Overall, 1-bromo-4-[(4-nitrophenyl)sulfanyl]benzene is of interest in synthetic organic chemistry and may have applications in materials science and pharmaceuticals.
Formula:C12H8BrNO2S
InChI:InChI=1/C12H8BrNO2S/c13-9-1-5-11(6-2-9)17-12-7-3-10(4-8-12)14(15)16/h1-8H
InChI key:XWPBPDJTKDECOY-UHFFFAOYSA-N
SMILES:c1cc(ccc1Br)Sc1ccc(cc1)N(=O)=O
Found 4 products.