CAS 219694-63-0
:Ingavirin
Description:
Ingavirin, with the CAS number 219694-63-0, is an antiviral medication primarily used in the treatment of influenza and other viral infections. It is characterized by its mechanism of action, which involves the modulation of the immune response and inhibition of viral replication. Ingavirin is known for its ability to enhance the production of interferons, which are proteins that play a crucial role in the body's defense against viral infections. The substance is typically administered orally and is recognized for its relatively low toxicity profile. Ingavirin is often noted for its rapid onset of action and is usually prescribed for use in the early stages of viral infections. Its chemical structure includes a core imidazole ring, contributing to its biological activity. While it is effective against various strains of influenza, its use should be guided by medical advice, considering potential contraindications and interactions with other medications. Overall, Ingavirin represents a significant option in antiviral therapy, particularly in regions where influenza is prevalent.
Formula:C10H15N3O3
InChI:InChI=1S/C10H15N3O3/c14-9(2-1-3-10(15)16)12-5-4-8-6-11-7-13-8/h6-7H,1-5H2,(H,11,13)(H,12,14)(H,15,16)
InChI key:KZIMLUFVKJLCCH-UHFFFAOYSA-N
SMILES:C1=C(NC=N1)CCNC(=O)CCCC(=O)O
Synonyms:- 5-[2-(1H-imidazol-5-yl)ethylamino]-5-oxopentanoic acid
- 5-((2-(1H-imidazol-5-yl)ethyl)amino)-5-oxopentanoic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
5-((2-(1H-Imidazol-5-yl)ethyl)amino)-5-oxopentanoic acid
CAS:5-((2-(1H-Imidazol-5-yl)ethyl)amino)-5-oxopentanoic acidFormula:C10H15N3O3Purity:95%Molecular weight:225.255-((2-(1H-Imidazol-5-Yl)Ethyl)Amino)-5-Oxopentanoic Acid
CAS:Formula:C10H15N3O3Purity:95%Color and Shape:SolidMolecular weight:225.2444Ingavirin
CAS:5-((2-(1H-Imidazol-5-yl)ethyl)amino)-5-oxopentanoic acidFormula:C10H15N3O3Purity:95%Molecular weight:225.244-{[2-(1H-Imidazol-5-yl)ethyl]carbamoyl}butanoic acid
CAS:4-{[2-(1H-Imidazol-5-yl)ethyl]carbamoyl}butanoic acid (4AICB) is a potent replication inhibitor of the influenza virus. It targets the viral RNA polymerase (RdRP), which is essential for virus replication and transcription. 4AICB inhibits the activity of RdRP by binding to its active site, thereby preventing the initiation of transcription. This mechanism of action has been shown to be effective against influenza A viruses and other RNA viruses. In addition, this drug has been shown to inhibit growth factor signaling pathways in human hematopoietic cells, which may be responsible for its anti-inflammatory effects. 4AICB also possesses pharmacokinetic properties that make it an ideal candidate for use as a diagnostic agent or as a treatment for inflammatory diseases. It can be administered orally or intravenously and is rapidly absorbed from the gastrointestinal tract or injected sites into systemic circulation, with rapidFormula:C10H15N3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:225.24 g/molIngavirin
CAS:Ingavirin, a novel inhibitor of the influenza virus reproduction, inhubits the formation of the virus specific hemagglutinin.Formula:C10H15N3O3Purity:98%Color and Shape:SolidMolecular weight:225.2444







